C9H13ClN4O6S2 — CID 11079252
[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]oxysulfonyloxymethylidene-dimethylazanium chloride (PubChem CID 11079252) has the molecular formula C9H13ClN4O6S2 and a molecular weight of 372.81 g/mol. Its IUPAC name is [(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]oxysulfonyloxymethylidene-dimethylazanium chloride.
| Compound Name | [(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]oxysulfonyloxymethylidene-dimethylazanium chloride |
|---|---|
| PubChem CID | 11079252 |
| Molecular Formula | C9H13ClN4O6S2 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | [(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]oxysulfonyloxymethylidene-dimethylazanium chloride |
| SMILES | CO/N=C(\C(=O)OS(=O)(=O)OC=[N+](C)C)c1csc(N)n1.[Cl-] |
| InChI | InChI=1S/C9H13N4O6S2.ClH/c1-13(2)5-18-21(15,16)19-8(14)7(12-17-3)6-4-20-9(10)11-6;/h4-5H,1-3H3,(H2,10,11);1H/q+1;/p-1/b12-7-; |
| InChIKey | GUBMQSHOWRUKHV-OZLKFZLXSA-M |
| XLogP | -3.82 |
| TPSA | 133.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|