C6H6F2N4O3S — CID 54451404
2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2,2-difluoroethoxyimino)acetic acid (PubChem CID 54451404) has the molecular formula C6H6F2N4O3S and a molecular weight of 252.20 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2,2-difluoroethoxyimino)acetic acid.
| Compound Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2,2-difluoroethoxyimino)acetic acid |
|---|---|
| PubChem CID | 54451404 |
| Molecular Formula | C6H6F2N4O3S |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2,2-difluoroethoxyimino)acetic acid |
| SMILES | Nc1nc(C(=NOCC(F)F)C(=O)O)ns1 |
| InChI | InChI=1S/C6H6F2N4O3S/c7-2(8)1-15-11-3(5(13)14)4-10-6(9)16-12-4/h2H,1H2,(H,13,14)(H2,9,10,12) |
| InChIKey | WVFVASUUNURWNZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|