C10H14N4O3S — CID 10754504
(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(3,3-dimethylcyclobutyl)oxyiminoacetic acid (PubChem CID 10754504) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(3,3-dimethylcyclobutyl)oxyiminoacetic acid.
| Compound Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(3,3-dimethylcyclobutyl)oxyiminoacetic acid |
|---|---|
| PubChem CID | 10754504 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(3,3-dimethylcyclobutyl)oxyiminoacetic acid |
| SMILES | CC1(C)CC(O/N=C(\C(=O)O)c2nsc(N)n2)C1 |
| InChI | InChI=1S/C10H14N4O3S/c1-10(2)3-5(4-10)17-13-6(8(15)16)7-12-9(11)18-14-7/h5H,3-4H2,1-2H3,(H,15,16)(H2,11,12,14)/b13-6- |
| InChIKey | IDICYBQNERESKS-MLPAPPSSSA-N |
| XLogP | 1.11 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|