C7H8N4O4S — CID 173411363
3-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxypropanoic acid (PubChem CID 173411363) has the molecular formula C7H8N4O4S and a molecular weight of 244.23 g/mol. Its IUPAC name is 3-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxypropanoic acid.
| Compound Name | 3-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 173411363 |
| Molecular Formula | C7H8N4O4S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 3-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxypropanoic acid |
| SMILES | Nc1nc(/C(C=O)=N\OCCC(=O)O)ns1 |
| InChI | InChI=1S/C7H8N4O4S/c8-7-9-6(11-16-7)4(3-12)10-15-2-1-5(13)14/h3H,1-2H2,(H,13,14)(H2,8,9,11)/b10-4- |
| InChIKey | YWIMGRQDJCLUDM-WMZJFQQLSA-N |
| XLogP | -0.49 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|