C6H10N6NaO4PS — CID 23707437
sodium (2Z)-2-[5-(diaminophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate (PubChem CID 23707437) has the molecular formula C6H10N6NaO4PS and a molecular weight of 316.22 g/mol. Its IUPAC name is sodium (2Z)-2-[5-(diaminophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate.
| Compound Name | sodium (2Z)-2-[5-(diaminophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate |
|---|---|
| PubChem CID | 23707437 |
| Molecular Formula | C6H10N6NaO4PS |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | sodium (2Z)-2-[5-(diaminophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate |
| SMILES | CCO/N=C(\C(=O)[O-])c1nsc(NP(N)(N)=O)n1.[Na+] |
| InChI | InChI=1S/C6H11N6O4PS.Na/c1-2-16-10-3(5(13)14)4-9-6(18-12-4)11-17(7,8)15;/h2H2,1H3,(H,13,14)(H5,7,8,9,11,12,15);/q;+1/p-1/b10-3-; |
| InChIKey | HETPOSLOSZDBNW-HVHUWTQGSA-M |
| XLogP | -4.53 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|