C19H21N7O8PS2+ — CID 54239330
(6S)-7-[[2-ethoxyimino-2-[5-(phosphonoamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54239330) has the molecular formula C19H21N7O8PS2+ and a molecular weight of 570.53 g/mol. Its IUPAC name is (6S)-7-[[2-ethoxyimino-2-[5-(phosphonoamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-ethoxyimino-2-[5-(phosphonoamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54239330 |
| Molecular Formula | C19H21N7O8PS2+ |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | (6S)-7-[[2-ethoxyimino-2-[5-(phosphonoamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3ccccc3)CS[C@@H]12)c1nsc(NP(=O)(O)O)n1 |
| InChI | InChI=1S/C19H20N7O8PS2/c1-2-34-22-11(14-21-19(37-24-14)23-35(31,32)33)15(27)20-12-16(28)26-13(18(29)30)10(9-36-17(12)26)8-25-6-4-3-5-7-25/h3-7,12,17H,2,8-9H2,1H3,(H4-,20,21,23,24,27,29,30,31,32,33)/p+1/t12?,17-/m0/s1 |
| InChIKey | QOWKKXHODYQDKO-TYJDENFWSA-O |
| XLogP | -0.49 |
| TPSA | 207.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|