C6H7ClN4O2S — CID 142784741
(2E)-2-[(2-amino-5-chloro-1,3-thiazol-4-yl)methoxyimino]acetamide (PubChem CID 142784741) has the molecular formula C6H7ClN4O2S and a molecular weight of 234.67 g/mol. Its IUPAC name is (2E)-2-[(2-amino-5-chloro-1,3-thiazol-4-yl)methoxyimino]acetamide.
| Compound Name | (2E)-2-[(2-amino-5-chloro-1,3-thiazol-4-yl)methoxyimino]acetamide |
|---|---|
| PubChem CID | 142784741 |
| Molecular Formula | C6H7ClN4O2S |
| Molecular Weight | 234.67 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | (2E)-2-[(2-amino-5-chloro-1,3-thiazol-4-yl)methoxyimino]acetamide |
| SMILES | NC(=O)/C=N/OCc1nc(N)sc1Cl |
| InChI | InChI=1S/C6H7ClN4O2S/c7-5-3(11-6(9)14-5)2-13-10-1-4(8)12/h1H,2H2,(H2,8,12)(H2,9,11)/b10-1+ |
| InChIKey | DENDEWSCRJWCDT-BCTAIJSYSA-N |
| XLogP | 0.37 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.67 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|