C6H6ClN3O2S — CID 74054264
[(2-amino-1,3-thiazol-4-yl)methylideneamino] 2-chloroacetate (PubChem CID 74054264) has the molecular formula C6H6ClN3O2S and a molecular weight of 219.65 g/mol. Its IUPAC name is [(2-amino-1,3-thiazol-4-yl)methylideneamino] 2-chloroacetate.
| Compound Name | [(2-amino-1,3-thiazol-4-yl)methylideneamino] 2-chloroacetate |
|---|---|
| PubChem CID | 74054264 |
| Molecular Formula | C6H6ClN3O2S |
| Molecular Weight | 219.65 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | [(2-amino-1,3-thiazol-4-yl)methylideneamino] 2-chloroacetate |
| SMILES | Nc1nc(C=NOC(=O)CCl)cs1 |
| InChI | InChI=1S/C6H6ClN3O2S/c7-1-5(11)12-9-2-4-3-13-6(8)10-4/h2-3H,1H2,(H2,8,10) |
| InChIKey | KNCOGXOWVRWQBU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|