C6H7N3O2S2 — CID 154451443
2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]ethanethioic S-acid (PubChem CID 154451443) has the molecular formula C6H7N3O2S2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]ethanethioic S-acid.
| Compound Name | 2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]ethanethioic S-acid |
|---|---|
| PubChem CID | 154451443 |
| Molecular Formula | C6H7N3O2S2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]ethanethioic S-acid |
| SMILES | Nc1nc(CON=CC(=O)S)cs1 |
| InChI | InChI=1S/C6H7N3O2S2/c7-6-9-4(3-13-6)2-11-8-1-5(10)12/h1,3H,2H2,(H2,7,9)(H,10,12) |
| InChIKey | FGEXGVRAEFBIFP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|