C11H13N5O8S3 — CID 56624591
2-[(2R,3R)-3-[[2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]acetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]sulfanylacetic acid (PubChem CID 56624591) has the molecular formula C11H13N5O8S3 and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-[(2R,3R)-3-[[2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]acetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[(2R,3R)-3-[[2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]acetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 56624591 |
| Molecular Formula | C11H13N5O8S3 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 2-[(2R,3R)-3-[[2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]acetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]sulfanylacetic acid |
| SMILES | Nc1nc(CON=CC(=O)N[C@@H]2C(=O)N(S(=O)(=O)O)[C@@H]2SCC(=O)O)cs1 |
| InChI | InChI=1S/C11H13N5O8S3/c12-11-14-5(3-26-11)2-24-13-1-6(17)15-8-9(20)16(27(21,22)23)10(8)25-4-7(18)19/h1,3,8,10H,2,4H2,(H2,12,14)(H,15,17)(H,18,19)(H,21,22,23)/t8-,10-/m1/s1 |
| InChIKey | MDHXSWOHKWECQQ-PSASIEDQSA-N |
| XLogP | -1.50 |
| TPSA | 201.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|