C13H15ClN6O5S2 — CID 56632120
2-[(2S,3R)-3-[[2-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl]amino]-4-oxoazetidin-2-yl]sulfanylacetamide (PubChem CID 56632120) has the molecular formula C13H15ClN6O5S2 and a molecular weight of 434.89 g/mol. Its IUPAC name is 2-[(2S,3R)-3-[[2-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl]amino]-4-oxoazetidin-2-yl]sulfanylacetamide.
| Compound Name | 2-[(2S,3R)-3-[[2-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl]amino]-4-oxoazetidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 56632120 |
| Molecular Formula | C13H15ClN6O5S2 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 2-[(2S,3R)-3-[[2-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl]amino]-4-oxoazetidin-2-yl]sulfanylacetamide |
| SMILES | NC(=O)CS[C@@H]1NC(=O)[C@H]1NC(=O)C=NOCc1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C13H15ClN6O5S2/c14-1-8(22)19-13-17-6(4-27-13)3-25-16-2-9(23)18-10-11(24)20-12(10)26-5-7(15)21/h2,4,10,12H,1,3,5H2,(H2,15,21)(H,18,23)(H,20,24)(H,17,19,22)/t10-,12+/m1/s1 |
| InChIKey | WBOKFHYCVXPVEI-PWSUYJOCSA-N |
| XLogP | -1.02 |
| TPSA | 164.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|