C15H19ClN6O5S2 — CID 88700803
(2Z)-N-[2-(2-acetamidoethylsulfanyl)-4-oxoazetidin-3-yl]-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetamide (PubChem CID 88700803) has the molecular formula C15H19ClN6O5S2 and a molecular weight of 462.94 g/mol. Its IUPAC name is (2Z)-N-[2-(2-acetamidoethylsulfanyl)-4-oxoazetidin-3-yl]-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetamide.
| Compound Name | (2Z)-N-[2-(2-acetamidoethylsulfanyl)-4-oxoazetidin-3-yl]-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 88700803 |
| Molecular Formula | C15H19ClN6O5S2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | (2Z)-N-[2-(2-acetamidoethylsulfanyl)-4-oxoazetidin-3-yl]-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetamide |
| SMILES | CO/N=C(\C(=O)NC1C(=O)NC1SCCNC(C)=O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C15H19ClN6O5S2/c1-7(23)17-3-4-28-14-11(13(26)21-14)20-12(25)10(22-27-2)8-6-29-15(18-8)19-9(24)5-16/h6,11,14H,3-5H2,1-2H3,(H,17,23)(H,20,25)(H,21,26)(H,18,19,24)/b22-10- |
| InChIKey | UTNKSDJPBOSVBJ-YVNNLAQVSA-N |
| XLogP | -0.52 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|