C15H16ClN7O6S — CID 13341829
(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2S,3S)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-4-oxoazetidin-3-yl]acetamide (PubChem CID 13341829) has the molecular formula C15H16ClN7O6S and a molecular weight of 457.86 g/mol. Its IUPAC name is (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2S,3S)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-4-oxoazetidin-3-yl]acetamide.
| Compound Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2S,3S)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-4-oxoazetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 13341829 |
| Molecular Formula | C15H16ClN7O6S |
| Molecular Weight | 457.86 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-N-[(2S,3S)-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-4-oxoazetidin-3-yl]acetamide |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N[C@H]1N1C(=O)CN(C)C1=O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C15H16ClN7O6S/c1-22-4-8(25)23(15(22)28)11-10(13(27)20-11)19-12(26)9(21-29-2)6-5-30-14(17-6)18-7(24)3-16/h5,10-11H,3-4H2,1-2H3,(H,19,26)(H,20,27)(H,17,18,24)/b21-9-/t10-,11-/m0/s1 |
| InChIKey | JXMZCGVZVDRCIO-HABURROYSA-N |
| XLogP | -1.49 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.86 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|