C17H18ClN5O6S — CID 88771277
(4R,6S,7R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88771277) has the molecular formula C17H18ClN5O6S and a molecular weight of 455.88 g/mol. Its IUPAC name is (4R,6S,7R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (4R,6S,7R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88771277 |
| Molecular Formula | C17H18ClN5O6S |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (4R,6S,7R)-7-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@H]1C(=O)N2C(C(=O)O)=C[C@H](C)C[C@@H]12)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C17H18ClN5O6S/c1-7-3-9-13(15(26)23(9)10(4-7)16(27)28)21-14(25)12(22-29-2)8-6-30-17(19-8)20-11(24)5-18/h4,6-7,9,13H,3,5H2,1-2H3,(H,21,25)(H,27,28)(H,19,20,24)/t7-,9+,13-/m1/s1 |
| InChIKey | NCIQOIOKVXRRPG-BZTNIEFMSA-N |
| XLogP | 0.37 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|