C9H13N3O3S — CID 151561122
(2-amino-1,3-thiazol-4-yl) 2-(2-methylpropoxyimino)acetate (PubChem CID 151561122) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl) 2-(2-methylpropoxyimino)acetate.
| Compound Name | (2-amino-1,3-thiazol-4-yl) 2-(2-methylpropoxyimino)acetate |
|---|---|
| PubChem CID | 151561122 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl) 2-(2-methylpropoxyimino)acetate |
| SMILES | CC(C)CON=CC(=O)Oc1csc(N)n1 |
| InChI | InChI=1S/C9H13N3O3S/c1-6(2)4-14-11-3-8(13)15-7-5-16-9(10)12-7/h3,5-6H,4H2,1-2H3,(H2,10,12) |
| InChIKey | QCMFWFQTOABRBT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|