C6H10N4OS — CID 166829588
(NE)-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)propylidene]hydroxylamine (PubChem CID 166829588) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is (NE)-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)propylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 166829588 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | (NE)-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)propylidene]hydroxylamine |
| SMILES | CC(N)/C(=N\O)c1csc(N)n1 |
| InChI | InChI=1S/C6H10N4OS/c1-3(7)5(10-11)4-2-12-6(8)9-4/h2-3,11H,7H2,1H3,(H2,8,9)/b10-5+ |
| InChIKey | RXQRNXCXJBSEDX-BJMVGYQFSA-N |
| XLogP | 0.25 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|