C5H5N3O3S — CID 88605381
(2-amino-1,3-thiazol-4-yl) (2Z)-2-hydroxyiminoacetate (PubChem CID 88605381) has the molecular formula C5H5N3O3S and a molecular weight of 187.18 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl) (2Z)-2-hydroxyiminoacetate.
| Compound Name | (2-amino-1,3-thiazol-4-yl) (2Z)-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 88605381 |
| Molecular Formula | C5H5N3O3S |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl) (2Z)-2-hydroxyiminoacetate |
| SMILES | Nc1nc(OC(=O)/C=N\O)cs1 |
| InChI | InChI=1S/C5H5N3O3S/c6-5-8-3(2-12-5)11-4(9)1-7-10/h1-2,10H,(H2,6,8)/b7-1- |
| InChIKey | USAQVFGCWHRULT-XFSBKJJWSA-N |
| XLogP | 0.09 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|