C6H8ClN3O3S — CID 174288958
(2-amino-1,3-thiazol-4-yl) 2-methoxyiminoacetate;hydrochloride (PubChem CID 174288958) has the molecular formula C6H8ClN3O3S and a molecular weight of 237.67 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl) 2-methoxyiminoacetate;hydrochloride.
| Compound Name | (2-amino-1,3-thiazol-4-yl) 2-methoxyiminoacetate;hydrochloride |
|---|---|
| PubChem CID | 174288958 |
| Molecular Formula | C6H8ClN3O3S |
| Molecular Weight | 237.67 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl) 2-methoxyiminoacetate;hydrochloride |
| SMILES | CON=CC(=O)Oc1csc(N)n1.Cl |
| InChI | InChI=1S/C6H7N3O3S.ClH/c1-11-8-2-5(10)12-4-3-13-6(7)9-4;/h2-3H,1H3,(H2,7,9);1H |
| InChIKey | QZHRQZZBZMVMLS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.67 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|