C9H9N7O3S — CID 57133896
2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]-3-oxo-4-(tetrazol-1-yl)butanal (PubChem CID 57133896) has the molecular formula C9H9N7O3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]-3-oxo-4-(tetrazol-1-yl)butanal.
| Compound Name | 2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]-3-oxo-4-(tetrazol-1-yl)butanal |
|---|---|
| PubChem CID | 57133896 |
| Molecular Formula | C9H9N7O3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-4-yl)methoxyimino]-3-oxo-4-(tetrazol-1-yl)butanal |
| SMILES | Nc1nc(CON=C(C=O)C(=O)Cn2cnnn2)cs1 |
| InChI | InChI=1S/C9H9N7O3S/c10-9-12-6(4-20-9)3-19-13-7(2-17)8(18)1-16-5-11-14-15-16/h2,4-5H,1,3H2,(H2,10,12) |
| InChIKey | VUWCPIXEENNYJF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|