C13H21N3OS — CID 62797286
2-(2-amino-1,3-thiazol-4-yl)-N-cyclohexyl-N-ethylacetamide (PubChem CID 62797286) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-cyclohexyl-N-ethylacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-cyclohexyl-N-ethylacetamide |
|---|---|
| PubChem CID | 62797286 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-cyclohexyl-N-ethylacetamide |
| SMILES | CCN(C(=O)Cc1csc(N)n1)C1CCCCC1 |
| InChI | InChI=1S/C13H21N3OS/c1-2-16(11-6-4-3-5-7-11)12(17)8-10-9-18-13(14)15-10/h9,11H,2-8H2,1H3,(H2,14,15) |
| InChIKey | KIZMQBDOSGCJCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |