C8H6Cl3N3O3S — CID 54260035
2-[[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl chloride (PubChem CID 54260035) has the molecular formula C8H6Cl3N3O3S and a molecular weight of 330.58 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl chloride.
| Compound Name | 2-[[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl chloride |
|---|---|
| PubChem CID | 54260035 |
| Molecular Formula | C8H6Cl3N3O3S |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | 2-[[5-chloro-2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methoxyimino]acetyl chloride |
| SMILES | O=C(Cl)C=NOCc1nc(NC(=O)CCl)sc1Cl |
| InChI | InChI=1S/C8H6Cl3N3O3S/c9-1-6(16)14-8-13-4(7(11)18-8)3-17-12-2-5(10)15/h2H,1,3H2,(H,13,14,16) |
| InChIKey | RCVUCVRASSGVSA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|