C14H13Cl2N4O4S+ — CID 143601212
[2,6-bis[(2-chloroacetyl)amino]-4-methoxycarbonyl-1,3-benzothiazol-7-yl]methylideneazanium (PubChem CID 143601212) has the molecular formula C14H13Cl2N4O4S+ and a molecular weight of 404.26 g/mol. Its IUPAC name is [2,6-bis[(2-chloroacetyl)amino]-4-methoxycarbonyl-1,3-benzothiazol-7-yl]methylideneazanium.
| Compound Name | [2,6-bis[(2-chloroacetyl)amino]-4-methoxycarbonyl-1,3-benzothiazol-7-yl]methylideneazanium |
|---|---|
| PubChem CID | 143601212 |
| Molecular Formula | C14H13Cl2N4O4S+ |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | [2,6-bis[(2-chloroacetyl)amino]-4-methoxycarbonyl-1,3-benzothiazol-7-yl]methylideneazanium |
| SMILES | COC(=O)c1cc(NC(=O)CCl)c(C=[NH2+])c2sc(NC(=O)CCl)nc12 |
| InChI | InChI=1S/C14H12Cl2N4O4S/c1-24-13(23)6-2-8(18-9(21)3-15)7(5-17)12-11(6)20-14(25-12)19-10(22)4-16/h2,5,17H,3-4H2,1H3,(H,18,21)(H,19,20,22)/p+1 |
| InChIKey | DIGJINFTNRCGNI-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|