C6H7ClN2O2S — CID 166431986
2-chloro-N-(5-methoxy-1,3-thiazol-2-yl)acetamide (PubChem CID 166431986) has the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. Its IUPAC name is 2-chloro-N-(5-methoxy-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-chloro-N-(5-methoxy-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 166431986 |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 2-chloro-N-(5-methoxy-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1cnc(NC(=O)CCl)s1 |
| InChI | InChI=1S/C6H7ClN2O2S/c1-11-5-3-8-6(12-5)9-4(10)2-7/h3H,2H2,1H3,(H,8,9,10) |
| InChIKey | XBHPPLBGBYHKOO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|