C10H15N3O4S2 — CID 136542648
1-(1,1-dioxothian-4-yl)-3-(5-methoxy-1,3-thiazol-2-yl)urea (PubChem CID 136542648) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-3-(5-methoxy-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1,1-dioxothian-4-yl)-3-(5-methoxy-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 136542648 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-3-(5-methoxy-1,3-thiazol-2-yl)urea |
| SMILES | COc1cnc(NC(=O)NC2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C10H15N3O4S2/c1-17-8-6-11-10(18-8)13-9(14)12-7-2-4-19(15,16)5-3-7/h6-7H,2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | COPZEGJJGLJTMG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |