C24H18KN3O3S — CID 139769615
potassium 2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate (PubChem CID 139769615) has the molecular formula C24H18KN3O3S and a molecular weight of 467.59 g/mol. Its IUPAC name is potassium 2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate.
| Compound Name | potassium 2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate |
|---|---|
| PubChem CID | 139769615 |
| Molecular Formula | C24H18KN3O3S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | potassium 2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate |
| SMILES | Nc1nc(C(=NOC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[O-])cs1.[K+] |
| InChI | InChI=1S/C24H19N3O3S.K/c25-23-26-20(16-31-23)21(22(28)29)27-30-24(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-16H,(H2,25,26)(H,28,29);/q;+1/p-1 |
| InChIKey | RMNLDJPUBNPXOL-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|