C30H22N6O3S — CID 14807373
benzotriazol-1-yl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate (PubChem CID 14807373) has the molecular formula C30H22N6O3S and a molecular weight of 546.61 g/mol. Its IUPAC name is benzotriazol-1-yl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate.
| Compound Name | benzotriazol-1-yl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate |
|---|---|
| PubChem CID | 14807373 |
| Molecular Formula | C30H22N6O3S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | benzotriazol-1-yl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetate |
| SMILES | Nc1nc(/C(=N/OC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)On2nnc3ccccc32)cs1 |
| InChI | InChI=1S/C30H22N6O3S/c31-29-32-25(20-40-29)27(28(37)38-36-26-19-11-10-18-24(26)33-35-36)34-39-30(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-20H,(H2,31,32)/b34-27- |
| InChIKey | NNXHTALPYXRANA-YLHCSOALSA-N |
| XLogP | 4.84 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|