C31H26ClN5O5S2 — CID 173307046
[2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl] (6R)-4-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173307046) has the molecular formula C31H26ClN5O5S2 and a molecular weight of 648.17 g/mol. Its IUPAC name is [2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl] (6R)-4-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | [2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl] (6R)-4-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173307046 |
| Molecular Formula | C31H26ClN5O5S2 |
| Molecular Weight | 648.17 g/mol |
| Exact Mass | 647.11 |
| IUPAC Name | [2-(2-amino-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl] (6R)-4-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | Nc1nc(C(=NOC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)OC(=O)C2(Cl)CN3C(=O)C[C@H]3SC2N)cs1 |
| InChI | InChI=1S/C31H26ClN5O5S2/c32-30(18-37-23(38)16-24(37)44-27(30)33)28(40)41-26(39)25(22-17-43-29(34)35-22)36-42-31(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,17,24,27H,16,18,33H2,(H2,34,35)/t24-,27?,30?/m1/s1 |
| InChIKey | WKYWYZIADMZNJS-YIOUDBMRSA-N |
| XLogP | 4.08 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|