C34H30N6O3S — CID 54481835
benzotriazol-1-yl 2-butoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 54481835) has the molecular formula C34H30N6O3S and a molecular weight of 602.72 g/mol. Its IUPAC name is benzotriazol-1-yl 2-butoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | benzotriazol-1-yl 2-butoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 54481835 |
| Molecular Formula | C34H30N6O3S |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | benzotriazol-1-yl 2-butoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCCCON=C(C(=O)On1nnc2ccccc21)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C34H30N6O3S/c1-2-3-23-42-38-31(32(41)43-40-30-22-14-13-21-28(30)37-39-40)29-24-44-33(35-29)36-34(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27/h4-22,24H,2-3,23H2,1H3,(H,35,36) |
| InChIKey | XPNNJGQUAAPNCQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|