C11H9N5O6S — CID 13069144
(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2-methoxy-5-nitrophenoxy)iminoacetic acid (PubChem CID 13069144) has the molecular formula C11H9N5O6S and a molecular weight of 339.29 g/mol. Its IUPAC name is (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2-methoxy-5-nitrophenoxy)iminoacetic acid.
| Compound Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2-methoxy-5-nitrophenoxy)iminoacetic acid |
|---|---|
| PubChem CID | 13069144 |
| Molecular Formula | C11H9N5O6S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(2-methoxy-5-nitrophenoxy)iminoacetic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1O/N=C(\C(=O)O)c1nsc(N)n1 |
| InChI | InChI=1S/C11H9N5O6S/c1-21-6-3-2-5(16(19)20)4-7(6)22-14-8(10(17)18)9-13-11(12)23-15-9/h2-4H,1H3,(H,17,18)(H2,12,13,15)/b14-8- |
| InChIKey | LJPLLRRQIPACKW-ZSOIEALJSA-N |
| XLogP | 0.90 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|