C10H7N3O6 — CID 104784413
5-(2-methoxy-4-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 104784413) has the molecular formula C10H7N3O6 and a molecular weight of 265.18 g/mol. Its IUPAC name is 5-(2-methoxy-4-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-(2-methoxy-4-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 104784413 |
| Molecular Formula | C10H7N3O6 |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 5-(2-methoxy-4-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1nc(C(=O)O)no1 |
| InChI | InChI=1S/C10H7N3O6/c1-18-7-4-5(13(16)17)2-3-6(7)9-11-8(10(14)15)12-19-9/h2-4H,1H3,(H,14,15) |
| InChIKey | CITUABUUYQXWBE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|