C9H6N4O5 — CID 112632051
5-(4-amino-3-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 112632051) has the molecular formula C9H6N4O5 and a molecular weight of 250.17 g/mol. Its IUPAC name is 5-(4-amino-3-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-(4-amino-3-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 112632051 |
| Molecular Formula | C9H6N4O5 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5-(4-amino-3-nitrophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | Nc1ccc(-c2nc(C(=O)O)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6N4O5/c10-5-2-1-4(3-6(5)13(16)17)8-11-7(9(14)15)12-18-8/h1-3H,10H2,(H,14,15) |
| InChIKey | QYJOTRQUPUFSGO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|