C14H16N6O3 — CID 2883569
2-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxy-4-nitrophenyl)guanidine (PubChem CID 2883569) has the molecular formula C14H16N6O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxy-4-nitrophenyl)guanidine.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxy-4-nitrophenyl)guanidine |
|---|---|
| PubChem CID | 2883569 |
| Molecular Formula | C14H16N6O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(2-methoxy-4-nitrophenyl)guanidine |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(N)=Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H16N6O3/c1-8-6-9(2)17-14(16-8)19-13(15)18-11-5-4-10(20(21)22)7-12(11)23-3/h4-7H,1-3H3,(H3,15,16,17,18,19) |
| InChIKey | PBQPBKQXIOQFIV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|