C20H27N5O — CID 58638779
1-(5-cyclohexyl-2-methoxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine (PubChem CID 58638779) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(5-cyclohexyl-2-methoxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine.
| Compound Name | 1-(5-cyclohexyl-2-methoxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 58638779 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-(5-cyclohexyl-2-methoxyphenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
| SMILES | COc1ccc(C2CCCCC2)cc1N/C(N)=N\c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C20H27N5O/c1-13-11-14(2)23-20(22-13)25-19(21)24-17-12-16(9-10-18(17)26-3)15-7-5-4-6-8-15/h9-12,15H,4-8H2,1-3H3,(H3,21,22,23,24,25) |
| InChIKey | FXPVHYIXXMNUAZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|