C12H11BrF2N2O2S — CID 172868672
tert-butyl N-(4-bromo-5,7-difluoro-1,3-benzothiazol-2-yl)carbamate (PubChem CID 172868672) has the molecular formula C12H11BrF2N2O2S and a molecular weight of 365.20 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-5,7-difluoro-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-bromo-5,7-difluoro-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 172868672 |
| Molecular Formula | C12H11BrF2N2O2S |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | tert-butyl N-(4-bromo-5,7-difluoro-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2c(Br)c(F)cc(F)c2s1 |
| InChI | InChI=1S/C12H11BrF2N2O2S/c1-12(2,3)19-11(18)17-10-16-8-7(13)5(14)4-6(15)9(8)20-10/h4H,1-3H3,(H,16,17,18) |
| InChIKey | ZFKGIVUKMLVUBF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|