C13H17BN2O4S — CID 170991937
[7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid (PubChem CID 170991937) has the molecular formula C13H17BN2O4S and a molecular weight of 308.17 g/mol. Its IUPAC name is [7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid.
| Compound Name | [7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 170991937 |
| Molecular Formula | C13H17BN2O4S |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid |
| SMILES | Cc1ccc(B(O)O)c2nc(NC(=O)OC(C)(C)C)sc12 |
| InChI | InChI=1S/C13H17BN2O4S/c1-7-5-6-8(14(18)19)9-10(7)21-11(15-9)16-12(17)20-13(2,3)4/h5-6,18-19H,1-4H3,(H,15,16,17) |
| InChIKey | KEWBGUOJXPQHBZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|