C19H22BN3O4S — CID 71132008
[2-(2,4-dimethyl-1,3-thiazol-5-yl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]quinolin-6-yl]boronic acid (PubChem CID 71132008) has the molecular formula C19H22BN3O4S and a molecular weight of 399.28 g/mol. Its IUPAC name is [2-(2,4-dimethyl-1,3-thiazol-5-yl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]quinolin-6-yl]boronic acid.
| Compound Name | [2-(2,4-dimethyl-1,3-thiazol-5-yl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]quinolin-6-yl]boronic acid |
|---|---|
| PubChem CID | 71132008 |
| Molecular Formula | C19H22BN3O4S |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [2-(2,4-dimethyl-1,3-thiazol-5-yl)-7-[(2-methylpropan-2-yl)oxycarbonylamino]quinolin-6-yl]boronic acid |
| SMILES | Cc1nc(C)c(-c2ccc3cc(B(O)O)c(NC(=O)OC(C)(C)C)cc3n2)s1 |
| InChI | InChI=1S/C19H22BN3O4S/c1-10-17(28-11(2)21-10)14-7-6-12-8-13(20(25)26)16(9-15(12)22-14)23-18(24)27-19(3,4)5/h6-9,25-26H,1-5H3,(H,23,24) |
| InChIKey | BEDHPNBEHQLPJX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|