C14H16BrFN2O3S — CID 134180779
tert-butyl N-[2-[(2-bromo-4-fluoro-1,3-benzothiazol-6-yl)oxy]ethyl]carbamate (PubChem CID 134180779) has the molecular formula C14H16BrFN2O3S and a molecular weight of 391.26 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-bromo-4-fluoro-1,3-benzothiazol-6-yl)oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-bromo-4-fluoro-1,3-benzothiazol-6-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 134180779 |
| Molecular Formula | C14H16BrFN2O3S |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | tert-butyl N-[2-[(2-bromo-4-fluoro-1,3-benzothiazol-6-yl)oxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc(F)c2nc(Br)sc2c1 |
| InChI | InChI=1S/C14H16BrFN2O3S/c1-14(2,3)21-13(19)17-4-5-20-8-6-9(16)11-10(7-8)22-12(15)18-11/h6-7H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | XTNQZESGTMPXEM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|