C13H12FN3O2S2 — CID 86667225
tert-butyl N-(5-fluoro-6-thiocyanato-1,3-benzothiazol-2-yl)carbamate (PubChem CID 86667225) has the molecular formula C13H12FN3O2S2 and a molecular weight of 325.39 g/mol. Its IUPAC name is tert-butyl N-(5-fluoro-6-thiocyanato-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-fluoro-6-thiocyanato-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 86667225 |
| Molecular Formula | C13H12FN3O2S2 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | tert-butyl N-(5-fluoro-6-thiocyanato-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2cc(F)c(SC#N)cc2s1 |
| InChI | InChI=1S/C13H12FN3O2S2/c1-13(2,3)19-12(18)17-11-16-8-4-7(14)9(20-6-15)5-10(8)21-11/h4-5H,1-3H3,(H,16,17,18) |
| InChIKey | QOXGBNGHWPUSPA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|