C16H18FN5OS2 — CID 88539505
[2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-5-fluoro-1,3-benzothiazol-6-yl] thiocyanate (PubChem CID 88539505) has the molecular formula C16H18FN5OS2 and a molecular weight of 379.49 g/mol. Its IUPAC name is [2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-5-fluoro-1,3-benzothiazol-6-yl] thiocyanate.
| Compound Name | [2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-5-fluoro-1,3-benzothiazol-6-yl] thiocyanate |
|---|---|
| PubChem CID | 88539505 |
| Molecular Formula | C16H18FN5OS2 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | [2-[[2-(4-ethylpiperazin-1-yl)acetyl]amino]-5-fluoro-1,3-benzothiazol-6-yl] thiocyanate |
| SMILES | CCN1CCN(CC(=O)Nc2nc3cc(F)c(SC#N)cc3s2)CC1 |
| InChI | InChI=1S/C16H18FN5OS2/c1-2-21-3-5-22(6-4-21)9-15(23)20-16-19-12-7-11(17)13(24-10-18)8-14(12)25-16/h7-8H,2-6,9H2,1H3,(H,19,20,23) |
| InChIKey | OCZGRVGDDTVDHD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|