C10H15N3O4 — CID 147916897
tert-butyl N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)carbamate (PubChem CID 147916897) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is tert-butyl N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)carbamate.
| Compound Name | tert-butyl N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)carbamate |
|---|---|
| PubChem CID | 147916897 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | tert-butyl N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)carbamate |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H15N3O4/c1-5-6(7(14)13-8(15)11-5)12-9(16)17-10(2,3)4/h1-4H3,(H,12,16)(H2,11,13,14,15) |
| InChIKey | IHFZFOYWCKEAOU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |