C10H14ClN5O3 — CID 20623978
tert-butyl N-(6-amino-5-carbamoyl-3-chloropyrazin-2-yl)carbamate (PubChem CID 20623978) has the molecular formula C10H14ClN5O3 and a molecular weight of 287.71 g/mol. Its IUPAC name is tert-butyl N-(6-amino-5-carbamoyl-3-chloropyrazin-2-yl)carbamate.
| Compound Name | tert-butyl N-(6-amino-5-carbamoyl-3-chloropyrazin-2-yl)carbamate |
|---|---|
| PubChem CID | 20623978 |
| Molecular Formula | C10H14ClN5O3 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | tert-butyl N-(6-amino-5-carbamoyl-3-chloropyrazin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(N)c(C(N)=O)nc1Cl |
| InChI | InChI=1S/C10H14ClN5O3/c1-10(2,3)19-9(18)16-8-5(11)14-4(7(13)17)6(12)15-8/h1-3H3,(H2,13,17)(H3,12,15,16,18) |
| InChIKey | WWDGCXPBJIONQJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |