C5H7Cl2N5 — CID 83019468
2-(4,6-dichloro-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine (PubChem CID 83019468) has the molecular formula C5H7Cl2N5 and a molecular weight of 208.05 g/mol. Its IUPAC name is 2-(4,6-dichloro-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(4,6-dichloro-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83019468 |
| Molecular Formula | C5H7Cl2N5 |
| Molecular Weight | 208.05 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 2-(4,6-dichloro-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C5H7Cl2N5/c1-12(2)11-5-9-3(6)8-4(7)10-5/h1-2H3,(H,8,9,10,11) |
| InChIKey | VTJPCDSVTAWULL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.05 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|