C9H15ClN6O — CID 83020025
2-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine (PubChem CID 83020025) has the molecular formula C9H15ClN6O and a molecular weight of 258.71 g/mol. Its IUPAC name is 2-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83020025 |
| Molecular Formula | C9H15ClN6O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1nc(Cl)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H15ClN6O/c1-15(2)14-8-11-7(10)12-9(13-8)16-3-5-17-6-4-16/h3-6H2,1-2H3,(H,11,12,13,14) |
| InChIKey | MTLVWZPOKMSUGD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|