C4H5Cl2N5 — CID 59513017
1-(4,6-dichloro-1,3,5-triazin-2-yl)-2-methylhydrazine (PubChem CID 59513017) has the molecular formula C4H5Cl2N5 and a molecular weight of 194.03 g/mol. Its IUPAC name is 1-(4,6-dichloro-1,3,5-triazin-2-yl)-2-methylhydrazine.
| Compound Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)-2-methylhydrazine |
|---|---|
| PubChem CID | 59513017 |
| Molecular Formula | C4H5Cl2N5 |
| Molecular Weight | 194.03 g/mol |
| Exact Mass | 192.99 |
| IUPAC Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)-2-methylhydrazine |
| SMILES | CNNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C4H5Cl2N5/c1-7-11-4-9-2(5)8-3(6)10-4/h7H,1H3,(H,8,9,10,11) |
| InChIKey | GSOIZQAKJTWBQW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.03 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|