About [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium)
[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) (PubChem CID 59966378) has the molecular formula C5H7ClN5Y2-
and a molecular weight of 350.41 g/mol. Its IUPAC name is [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium).
Molecular Properties
| Compound Name | [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) |
| PubChem CID | 59966378 |
| Molecular Formula | C5H7ClN5Y2- |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 349.85 |
| IUPAC Name | [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) |
| SMILES | C[N-]c1nc(Cl)nc(NC)n1.[Y].[Y] |
| InChI | InChI=1S/C5H7ClN5.2Y/c1-7-4-9-3(6)10-5(8-2)11-4;;/h1-2H3,(H-,7,8,9,10,11);;/q-1;; |
| InChIKey | RDBUMXGISSRNLW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium)?
The IUPAC name of [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) (CID 59966378) is [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium).
What is the SMILES notation for [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium)?
The canonical SMILES for [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) is C[N-]c1nc(Cl)nc(NC)n1.[Y].[Y].
What is the InChIKey of [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium)?
The InChIKey is RDBUMXGISSRNLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN5.2Y/c1-7-4-9-3(6)10-5(8-2)11-4;;/h1-2H3,(H-,7,8,9,10,11);;/q-1;;.
What are the key properties of [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium)?
[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) has a molecular weight of 350.41 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-methylazanide;bis(yttrium) is sourced from PubChem (CID 59966378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).