C10H6ClF4N5 — CID 107647067
6-chloro-4-N-methyl-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 107647067) has the molecular formula C10H6ClF4N5 and a molecular weight of 307.64 g/mol. Its IUPAC name is 6-chloro-4-N-methyl-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-methyl-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 107647067 |
| Molecular Formula | C10H6ClF4N5 |
| Molecular Weight | 307.64 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 6-chloro-4-N-methyl-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Cl)nc(Nc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C10H6ClF4N5/c1-16-9-18-8(11)19-10(20-9)17-7-5(14)3(12)2-4(13)6(7)15/h2H,1H3,(H2,16,17,18,19,20) |
| InChIKey | IANKRPYFILPYRL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|