C7H11ClN6O — CID 174380953
N-[4-chloro-6-(2,2-dimethylhydrazinyl)-1,3,5-triazin-2-yl]-N-methylformamide (PubChem CID 174380953) has the molecular formula C7H11ClN6O and a molecular weight of 230.66 g/mol. Its IUPAC name is N-[4-chloro-6-(2,2-dimethylhydrazinyl)-1,3,5-triazin-2-yl]-N-methylformamide.
| Compound Name | N-[4-chloro-6-(2,2-dimethylhydrazinyl)-1,3,5-triazin-2-yl]-N-methylformamide |
|---|---|
| PubChem CID | 174380953 |
| Molecular Formula | C7H11ClN6O |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-[4-chloro-6-(2,2-dimethylhydrazinyl)-1,3,5-triazin-2-yl]-N-methylformamide |
| SMILES | CN(C)Nc1nc(Cl)nc(N(C)C=O)n1 |
| InChI | InChI=1S/C7H11ClN6O/c1-13(2)12-6-9-5(8)10-7(11-6)14(3)4-15/h4H,1-3H3,(H,9,10,11,12) |
| InChIKey | BXSXMFTUJWINMQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|