C8H14ClN5O — CID 163693056
6-chloro-2-N-ethoxy-4-N-ethyl-2-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 163693056) has the molecular formula C8H14ClN5O and a molecular weight of 231.69 g/mol. Its IUPAC name is 6-chloro-2-N-ethoxy-4-N-ethyl-2-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-ethoxy-4-N-ethyl-2-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 163693056 |
| Molecular Formula | C8H14ClN5O |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 6-chloro-2-N-ethoxy-4-N-ethyl-2-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Cl)nc(N(C)OCC)n1 |
| InChI | InChI=1S/C8H14ClN5O/c1-4-10-7-11-6(9)12-8(13-7)14(3)15-5-2/h4-5H2,1-3H3,(H,10,11,12,13) |
| InChIKey | JUPJAWALCWQFND-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|