C9H11BCl2FN10 — CID 18343810
CID 18343810 (PubChem CID 18343810) has the molecular formula C9H11BCl2FN10 and a molecular weight of 359.97 g/mol.
| Compound Name | CID 18343810 |
|---|---|
| PubChem CID | 18343810 |
| Molecular Formula | C9H11BCl2FN10 |
| Molecular Weight | 359.97 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | — |
| SMILES | CNc1nc(Cl)nc(N(C)[B]N(C)c2nc(Cl)nc(NF)n2)n1 |
| InChI | InChI=1S/C9H11BCl2FN10/c1-14-6-15-4(11)17-8(19-6)22(2)10-23(3)9-18-5(12)16-7(20-9)21-13/h1-3H3,(H,14,15,17,19)(H,16,18,20,21) |
| InChIKey | RCMXRMJCDHHWIK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.97 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|