C12H22ClN5 — CID 80809869
6-chloro-4-N-methyl-2-N-pentyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80809869) has the molecular formula C12H22ClN5 and a molecular weight of 271.80 g/mol. Its IUPAC name is 6-chloro-4-N-methyl-2-N-pentyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-methyl-2-N-pentyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80809869 |
| Molecular Formula | C12H22ClN5 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 6-chloro-4-N-methyl-2-N-pentyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCN(c1nc(Cl)nc(NC)n1)C(C)C |
| InChI | InChI=1S/C12H22ClN5/c1-5-6-7-8-18(9(2)3)12-16-10(13)15-11(14-4)17-12/h9H,5-8H2,1-4H3,(H,14,15,16,17) |
| InChIKey | ARMUMIRRPAOTQX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|